C25H29FN6 — CID 110089375
4-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-6-piperidin-1-yl-2-pyrazin-2-ylpyrimidine (PubChem CID 110089375) has the molecular formula C25H29FN6 and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-6-piperidin-1-yl-2-pyrazin-2-ylpyrimidine.
| Compound Name | 4-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-6-piperidin-1-yl-2-pyrazin-2-ylpyrimidine |
|---|---|
| PubChem CID | 110089375 |
| Molecular Formula | C25H29FN6 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-6-piperidin-1-yl-2-pyrazin-2-ylpyrimidine |
| SMILES | Fc1ccccc1CN1CCC(c2cc(N3CCCCC3)nc(-c3cnccn3)n2)CC1 |
| InChI | InChI=1S/C25H29FN6/c26-21-7-3-2-6-20(21)18-31-14-8-19(9-15-31)22-16-24(32-12-4-1-5-13-32)30-25(29-22)23-17-27-10-11-28-23/h2-3,6-7,10-11,16-17,19H,1,4-5,8-9,12-15,18H2 |
| InChIKey | GIGNBAJDABZJDM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |