C14H18O — CID 11009003
(1E,3R)-4,4-dimethyl-1-phenylhexa-1,5-dien-3-ol (PubChem CID 11009003) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1E,3R)-4,4-dimethyl-1-phenylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3R)-4,4-dimethyl-1-phenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 11009003 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1E,3R)-4,4-dimethyl-1-phenylhexa-1,5-dien-3-ol |
| SMILES | C=CC(C)(C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-4-14(2,3)13(15)11-10-12-8-6-5-7-9-12/h4-11,13,15H,1H2,2-3H3/b11-10+/t13-/m1/s1 |
| InChIKey | KPGHWQJYIAGJEQ-OCHBPSSRSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|