About 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide
2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide (PubChem CID 110090225) has the molecular formula C13H20N4O2S
and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide |
| PubChem CID | 110090225 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide |
| SMILES | CC(=O)NC(c1nccs1)C1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C13H20N4O2S/c1-9(18)16-12(13-15-4-7-20-13)10-2-5-17(6-3-10)8-11(14)19/h4,7,10,12H,2-3,5-6,8H2,1H3,(H2,14,19)(H,16,18) |
| InChIKey | AVDDVFGFKRZWQZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide?
The IUPAC name of 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide (CID 110090225) is 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide.
What is the SMILES notation for 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide?
The canonical SMILES for 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide is CC(=O)NC(c1nccs1)C1CCN(CC(N)=O)CC1.
What is the InChIKey of 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide?
The InChIKey is AVDDVFGFKRZWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2S/c1-9(18)16-12(13-15-4-7-20-13)10-2-5-17(6-3-10)8-11(14)19/h4,7,10,12H,2-3,5-6,8H2,1H3,(H2,14,19)(H,16,18).
What are the key properties of 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide?
2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide has a molecular weight of 296.40 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[acetamido(1,3-thiazol-2-yl)methyl]piperidin-1-yl]acetamide is sourced from PubChem (CID 110090225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).