C22H23N3O2 — CID 110090461
(2-methoxy-3-pyridinyl)-[4-(quinolin-4-ylmethyl)piperidin-1-yl]methanone (PubChem CID 110090461) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (2-methoxy-3-pyridinyl)-[4-(quinolin-4-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (2-methoxy-3-pyridinyl)-[4-(quinolin-4-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110090461 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2-methoxy-3-pyridinyl)-[4-(quinolin-4-ylmethyl)piperidin-1-yl]methanone |
| SMILES | COc1ncccc1C(=O)N1CCC(Cc2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C22H23N3O2/c1-27-21-19(6-4-11-24-21)22(26)25-13-9-16(10-14-25)15-17-8-12-23-20-7-3-2-5-18(17)20/h2-8,11-12,16H,9-10,13-15H2,1H3 |
| InChIKey | HPCRFTUDDWBAOI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |