C16H20N4O2 — CID 110091031
6-(3,5-dimethylpyrazol-1-yl)-N-(oxan-4-yl)pyridine-3-carboxamide (PubChem CID 110091031) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-N-(oxan-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(oxan-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110091031 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(oxan-4-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)NC3CCOCC3)cn2)n1 |
| InChI | InChI=1S/C16H20N4O2/c1-11-9-12(2)20(19-11)15-4-3-13(10-17-15)16(21)18-14-5-7-22-8-6-14/h3-4,9-10,14H,5-8H2,1-2H3,(H,18,21) |
| InChIKey | DLGAFGUZSFLZAY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |