C18H20N4O2S — CID 110091226
7-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 110091226) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 7-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 110091226 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 7-[1-(2-methylphenyl)sulfonylpiperidin-4-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCC(c2ccnc3ccnn23)CC1 |
| InChI | InChI=1S/C18H20N4O2S/c1-14-4-2-3-5-17(14)25(23,24)21-12-8-15(9-13-21)16-6-10-19-18-7-11-20-22(16)18/h2-7,10-11,15H,8-9,12-13H2,1H3 |
| InChIKey | VBEJYAZRUOHYED-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |