C9H11N3O3 — CID 110091367
5-(3-hydroxypyrrolidine-1-carbonyl)-1H-pyrimidin-6-one (PubChem CID 110091367) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 5-(3-hydroxypyrrolidine-1-carbonyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-hydroxypyrrolidine-1-carbonyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 110091367 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 5-(3-hydroxypyrrolidine-1-carbonyl)-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc[nH]c1=O)N1CCC(O)C1 |
| InChI | InChI=1S/C9H11N3O3/c13-6-1-2-12(4-6)9(15)7-3-10-5-11-8(7)14/h3,5-6,13H,1-2,4H2,(H,10,11,14) |
| InChIKey | GNWQBOGCDQAPQC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |