C18H23NO4 — CID 110091397
2-[2,7-dimethyl-2-(4-methylpent-3-enyl)-5-oxopyrano[3,2-c]pyridin-6-yl]acetic acid (PubChem CID 110091397) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[2,7-dimethyl-2-(4-methylpent-3-enyl)-5-oxopyrano[3,2-c]pyridin-6-yl]acetic acid.
| Compound Name | 2-[2,7-dimethyl-2-(4-methylpent-3-enyl)-5-oxopyrano[3,2-c]pyridin-6-yl]acetic acid |
|---|---|
| PubChem CID | 110091397 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[2,7-dimethyl-2-(4-methylpent-3-enyl)-5-oxopyrano[3,2-c]pyridin-6-yl]acetic acid |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(cc(C)n(CC(=O)O)c2=O)O1 |
| InChI | InChI=1S/C18H23NO4/c1-12(2)6-5-8-18(4)9-7-14-15(23-18)10-13(3)19(17(14)22)11-16(20)21/h6-7,9-10H,5,8,11H2,1-4H3,(H,20,21) |
| InChIKey | FHJCUQDJRCGOID-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|