About (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid
(4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 11009168) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 11009168 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(c2ccccc2)N1 |
| InChI | InChI=1S/C10H11NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,12,13)/t8-,9?/m0/s1 |
| InChIKey | AZDYQBFYMBALBY-IENPIDJESA-N |
| XLogP | 1.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid (CID 11009168) is (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid is O=C(O)[C@@H]1CSC(c2ccccc2)N1.
What is the InChIKey of (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is AZDYQBFYMBALBY-IENPIDJESA-N. The full InChI is InChI=1S/C10H11NO2S/c12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2,(H,12,13)/t8-,9?/m0/s1.
What are the key properties of (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid?
(4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 209.27 g/mol, XLogP of 1.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-phenyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 11009168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).