About 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene
11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene (PubChem CID 11009197) has the molecular formula C13H19FO
and a molecular weight of 210.29 g/mol. Its IUPAC name is 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene.
Molecular Properties
| Compound Name | 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene |
| PubChem CID | 11009197 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene |
| SMILES | CCOC1(F)C2=CC=CC1CCCCC2 |
| InChI | InChI=1S/C13H19FO/c1-2-15-13(14)11-7-4-3-5-8-12(13)10-6-9-11/h6,9-11H,2-5,7-8H2,1H3 |
| InChIKey | JPKAXFAWUHQUOE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene?
The IUPAC name of 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene (CID 11009197) is 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene.
What is the SMILES notation for 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene?
The canonical SMILES for 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene is CCOC1(F)C2=CC=CC1CCCCC2.
What is the InChIKey of 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene?
The InChIKey is JPKAXFAWUHQUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FO/c1-2-15-13(14)11-7-4-3-5-8-12(13)10-6-9-11/h6,9-11H,2-5,7-8H2,1H3.
What are the key properties of 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene?
11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene has a molecular weight of 210.29 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethoxy-11-fluorobicyclo[5.3.1]undeca-1(10),8-diene is sourced from PubChem (CID 11009197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).