C28H24FNO4 — CID 1100925
(15R,19S)-1-(dimethoxymethyl)-17-[(4-fluorophenyl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1100925) has the molecular formula C28H24FNO4 and a molecular weight of 457.50 g/mol. Its IUPAC name is (15R,19S)-1-(dimethoxymethyl)-17-[(4-fluorophenyl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-1-(dimethoxymethyl)-17-[(4-fluorophenyl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1100925 |
| Molecular Formula | C28H24FNO4 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (15R,19S)-1-(dimethoxymethyl)-17-[(4-fluorophenyl)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COC(OC)C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(Cc3ccc(F)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C28H24FNO4/c1-33-27(34-2)28-20-9-5-3-7-18(20)22(19-8-4-6-10-21(19)28)23-24(28)26(32)30(25(23)31)15-16-11-13-17(29)14-12-16/h3-14,22-24,27H,15H2,1-2H3/t22?,23-,24-,28?/m0/s1 |
| InChIKey | ABVBYNVQUIODDO-BAWWGMJKSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|