About 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal
3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal (PubChem CID 11009255) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal.
Molecular Properties
| Compound Name | 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal |
| PubChem CID | 11009255 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal |
| SMILES | C=CCC1(CCC=O)COC(C)(C)OC1 |
| InChI | InChI=1S/C12H20O3/c1-4-6-12(7-5-8-13)9-14-11(2,3)15-10-12/h4,8H,1,5-7,9-10H2,2-3H3 |
| InChIKey | RKSRNXIZEQZAEV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal?
The IUPAC name of 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal (CID 11009255) is 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal.
What is the SMILES notation for 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal?
The canonical SMILES for 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal is C=CCC1(CCC=O)COC(C)(C)OC1.
What is the InChIKey of 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal?
The InChIKey is RKSRNXIZEQZAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-6-12(7-5-8-13)9-14-11(2,3)15-10-12/h4,8H,1,5-7,9-10H2,2-3H3.
What are the key properties of 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal?
3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal has a molecular weight of 212.29 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)propanal is sourced from PubChem (CID 11009255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).