C14H16Si — CID 11009267
trimethyl-[(7E,9E)-undeca-7,9-dien-1,3,5-triynyl]silane (PubChem CID 11009267) has the molecular formula C14H16Si and a molecular weight of 212.37 g/mol. Its IUPAC name is trimethyl-[(7E,9E)-undeca-7,9-dien-1,3,5-triynyl]silane.
| Compound Name | trimethyl-[(7E,9E)-undeca-7,9-dien-1,3,5-triynyl]silane |
|---|---|
| PubChem CID | 11009267 |
| Molecular Formula | C14H16Si |
| Molecular Weight | 212.37 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | trimethyl-[(7E,9E)-undeca-7,9-dien-1,3,5-triynyl]silane |
| SMILES | C/C=C/C=C/C#CC#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H16Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h5-8H,1-4H3/b6-5+,8-7+ |
| InChIKey | ZYEOSQIOHJVHTA-BSWSSELBSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|