About N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide
N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide (PubChem CID 110093251) has the molecular formula C15H20N4O2S2
and a molecular weight of 352.49 g/mol. Its IUPAC name is N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide |
| PubChem CID | 110093251 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(c2ccc(-c3nccs3)cn2)C1 |
| InChI | InChI=1S/C15H20N4O2S2/c1-18(2)23(20,21)19-8-3-4-13(11-19)14-6-5-12(10-17-14)15-16-7-9-22-15/h5-7,9-10,13H,3-4,8,11H2,1-2H3 |
| InChIKey | INAJWBUGSGGRCX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide?
The IUPAC name of N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide (CID 110093251) is N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide.
What is the SMILES notation for N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide?
The canonical SMILES for N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide is CN(C)S(=O)(=O)N1CCCC(c2ccc(-c3nccs3)cn2)C1.
What is the InChIKey of N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide?
The InChIKey is INAJWBUGSGGRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2S2/c1-18(2)23(20,21)19-8-3-4-13(11-19)14-6-5-12(10-17-14)15-16-7-9-22-15/h5-7,9-10,13H,3-4,8,11H2,1-2H3.
What are the key properties of N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide?
N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide has a molecular weight of 352.49 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-[5-(1,3-thiazol-2-yl)-2-pyridinyl]piperidine-1-sulfonamide is sourced from PubChem (CID 110093251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).