C27H35N5O — CID 110093470
8-(2-phenylethyl)-3-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]-3,8-diazaspiro[5.6]dodec-10-en-7-one (PubChem CID 110093470) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is 8-(2-phenylethyl)-3-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]-3,8-diazaspiro[5.6]dodec-10-en-7-one.
| Compound Name | 8-(2-phenylethyl)-3-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]-3,8-diazaspiro[5.6]dodec-10-en-7-one |
|---|---|
| PubChem CID | 110093470 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 8-(2-phenylethyl)-3-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]-3,8-diazaspiro[5.6]dodec-10-en-7-one |
| SMILES | O=C1N(CCc2ccccc2)CC=CCC12CCN(Cc1ccnc(N3CCCC3)n1)CC2 |
| InChI | InChI=1S/C27H35N5O/c33-25-27(12-4-5-16-31(25)19-11-23-8-2-1-3-9-23)13-20-30(21-14-27)22-24-10-15-28-26(29-24)32-17-6-7-18-32/h1-5,8-10,15H,6-7,11-14,16-22H2 |
| InChIKey | OJKWLHLMFYSFTR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|