C13H17NO2 — CID 11009473
(2R,3R,4R)-1-benzyl-2-ethenylpyrrolidine-3,4-diol (PubChem CID 11009473) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2R,3R,4R)-1-benzyl-2-ethenylpyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R)-1-benzyl-2-ethenylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11009473 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2R,3R,4R)-1-benzyl-2-ethenylpyrrolidine-3,4-diol |
| SMILES | C=C[C@@H]1[C@@H](O)[C@H](O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-11-13(16)12(15)9-14(11)8-10-6-4-3-5-7-10/h2-7,11-13,15-16H,1,8-9H2/t11-,12-,13-/m1/s1 |
| InChIKey | VPPBWKFVMFNCNP-JHJVBQTASA-N |
| XLogP | 0.78 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|