About 2-imino-7-methoxy-1,3-dimethylpteridin-4-one
2-imino-7-methoxy-1,3-dimethylpteridin-4-one (PubChem CID 11009520) has the molecular formula C9H11N5O2
and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-imino-7-methoxy-1,3-dimethylpteridin-4-one.
Molecular Properties
| Compound Name | 2-imino-7-methoxy-1,3-dimethylpteridin-4-one |
| PubChem CID | 11009520 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-imino-7-methoxy-1,3-dimethylpteridin-4-one |
| SMILES | [H]/N=c1\n(C)c(=O)c2ncc(OC)nc2n1C |
| InChI | InChI=1S/C9H11N5O2/c1-13-7-6(8(15)14(2)9(13)10)11-4-5(12-7)16-3/h4,10H,1-3H3/b10-9- |
| InChIKey | ZGHBXSRYRMJDRC-KTKRTIGZSA-N |
| XLogP | -0.84 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-imino-7-methoxy-1,3-dimethylpteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-7-methoxy-1,3-dimethylpteridin-4-one?
The IUPAC name of 2-imino-7-methoxy-1,3-dimethylpteridin-4-one (CID 11009520) is 2-imino-7-methoxy-1,3-dimethylpteridin-4-one.
What is the SMILES notation for 2-imino-7-methoxy-1,3-dimethylpteridin-4-one?
The canonical SMILES for 2-imino-7-methoxy-1,3-dimethylpteridin-4-one is [H]/N=c1\n(C)c(=O)c2ncc(OC)nc2n1C.
What is the InChIKey of 2-imino-7-methoxy-1,3-dimethylpteridin-4-one?
The InChIKey is ZGHBXSRYRMJDRC-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H11N5O2/c1-13-7-6(8(15)14(2)9(13)10)11-4-5(12-7)16-3/h4,10H,1-3H3/b10-9-.
What are the key properties of 2-imino-7-methoxy-1,3-dimethylpteridin-4-one?
2-imino-7-methoxy-1,3-dimethylpteridin-4-one has a molecular weight of 221.22 g/mol, XLogP of -0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-7-methoxy-1,3-dimethylpteridin-4-one is sourced from PubChem (CID 11009520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).