C14H26N2 — CID 11009568
(6S,8aS)-N,N,5,5,8a-pentamethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine (PubChem CID 11009568) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (6S,8aS)-N,N,5,5,8a-pentamethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine.
| Compound Name | (6S,8aS)-N,N,5,5,8a-pentamethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 11009568 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (6S,8aS)-N,N,5,5,8a-pentamethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine |
| SMILES | CN(C)[C@H]1CC[C@]2(C)CNCC=C2C1(C)C |
| InChI | InChI=1S/C14H26N2/c1-13(2)11-7-9-15-10-14(11,3)8-6-12(13)16(4)5/h7,12,15H,6,8-10H2,1-5H3/t12-,14+/m0/s1 |
| InChIKey | KERIHFABCCWYSE-GXTWGEPZSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|