C14H24O2 — CID 11009617
(6E,10E)-12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one (PubChem CID 11009617) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (6E,10E)-12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one.
| Compound Name | (6E,10E)-12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one |
|---|---|
| PubChem CID | 11009617 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (6E,10E)-12-hydroxy-6,10-dimethyldodeca-6,10-dien-2-one |
| SMILES | CC(=O)CCC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C14H24O2/c1-12(8-5-9-14(3)16)6-4-7-13(2)10-11-15/h6,10,15H,4-5,7-9,11H2,1-3H3/b12-6+,13-10+ |
| InChIKey | VZDNKMDQWSQDRS-WAAHFECUSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|