C19H22N2O2 — CID 110096907
[(3aR,4R,6aS)-4-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone (PubChem CID 110096907) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 110096907 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [(3aR,4R,6aS)-4-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2C[C@H]3CC[C@H](Cc4ccccc4)[C@H]3C2)co1 |
| InChI | InChI=1S/C19H22N2O2/c1-13-20-18(12-23-13)19(22)21-10-16-8-7-15(17(16)11-21)9-14-5-3-2-4-6-14/h2-6,12,15-17H,7-11H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | SBELHPSYCZKZCQ-BRWVUGGUSA-N |
| XLogP | 3.32 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |