C12H20O4 — CID 11009713
Propanedioic acid, (1,1-dimethyl-2-propenyl)-, diethyl ester (PubChem CID 11009713) has the molecular formula C12H20O4 and a molecular weight of 228.28 g/mol. Its IUPAC name is diethyl 2-(2-methylbut-3-en-2-yl)propanedioate.
| Compound Name | Propanedioic acid, (1,1-dimethyl-2-propenyl)-, diethyl ester |
|---|---|
| PubChem CID | 11009713 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | diethyl 2-(2-methylbut-3-en-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C=C |
| InChI | InChI=1S/C12H20O4/c1-6-12(4,5)9(10(13)15-7-2)11(14)16-8-3/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | QMJRNFWBXIXUGR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | 250 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|