About 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate
1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 11009740) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| PubChem CID | 11009740 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OCCN(C)C |
| InChI | InChI=1S/C11H19NO4/c1-9(2)16-11(14)6-5-10(13)15-8-7-12(3)4/h5-6,9H,7-8H2,1-4H3/b6-5+ |
| InChIKey | WAOWSLNUQUOMQI-AATRIKPKSA-N |
| XLogP | 0.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The IUPAC name of 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate (CID 11009740) is 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
What is the SMILES notation for 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The canonical SMILES for 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate is CC(C)OC(=O)/C=C/C(=O)OCCN(C)C.
What is the InChIKey of 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The InChIKey is WAOWSLNUQUOMQI-AATRIKPKSA-N. The full InChI is InChI=1S/C11H19NO4/c1-9(2)16-11(14)6-5-10(13)15-8-7-12(3)4/h5-6,9H,7-8H2,1-4H3/b6-5+.
What are the key properties of 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate has a molecular weight of 229.28 g/mol, XLogP of 0.60, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(dimethylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate is sourced from PubChem (CID 11009740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).