About 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne
1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne (PubChem CID 11009757) has the molecular formula C7H10F3O3P
and a molecular weight of 230.12 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne |
| PubChem CID | 11009757 |
| Molecular Formula | C7H10F3O3P |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne |
| SMILES | CCOP(=O)(C#CC(F)(F)F)OCC |
| InChI | InChI=1S/C7H10F3O3P/c1-3-12-14(11,13-4-2)6-5-7(8,9)10/h3-4H2,1-2H3 |
| InChIKey | KSPDHXSREUTSBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne?
The IUPAC name of 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne (CID 11009757) is 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne.
What is the SMILES notation for 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne?
The canonical SMILES for 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne is CCOP(=O)(C#CC(F)(F)F)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne?
The InChIKey is KSPDHXSREUTSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3O3P/c1-3-12-14(11,13-4-2)6-5-7(8,9)10/h3-4H2,1-2H3.
What are the key properties of 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne?
1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne has a molecular weight of 230.12 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-yne is sourced from PubChem (CID 11009757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).