About 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate
2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate (PubChem CID 11009849) has the molecular formula C10H12BF4N
and a molecular weight of 233.02 g/mol. Its IUPAC name is 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate |
| PubChem CID | 11009849 |
| Molecular Formula | C10H12BF4N |
| Molecular Weight | 233.02 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate |
| SMILES | C[N+]1=Cc2ccccc2CC1.F[B-](F)(F)F |
| InChI | InChI=1S/C10H12N.BF4/c1-11-7-6-9-4-2-3-5-10(9)8-11;2-1(3,4)5/h2-5,8H,6-7H2,1H3;/q+1;-1 |
| InChIKey | UBHNYMDLRBMBGT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.02 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate?
The IUPAC name of 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate (CID 11009849) is 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate.
What is the SMILES notation for 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate?
The canonical SMILES for 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate is C[N+]1=Cc2ccccc2CC1.F[B-](F)(F)F.
What is the InChIKey of 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate?
The InChIKey is UBHNYMDLRBMBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N.BF4/c1-11-7-6-9-4-2-3-5-10(9)8-11;2-1(3,4)5/h2-5,8H,6-7H2,1H3;/q+1;-1.
What are the key properties of 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate?
2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate has a molecular weight of 233.02 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydroisoquinolin-2-ium tetrafluoroborate is sourced from PubChem (CID 11009849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).