C16H15N5O3 — CID 110098582
2-[4-[[(1-methylpyrazole-3-carbonyl)amino]methyl]imidazol-1-yl]benzoic acid (PubChem CID 110098582) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[4-[[(1-methylpyrazole-3-carbonyl)amino]methyl]imidazol-1-yl]benzoic acid.
| Compound Name | 2-[4-[[(1-methylpyrazole-3-carbonyl)amino]methyl]imidazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 110098582 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[4-[[(1-methylpyrazole-3-carbonyl)amino]methyl]imidazol-1-yl]benzoic acid |
| SMILES | Cn1ccc(C(=O)NCc2cn(-c3ccccc3C(=O)O)cn2)n1 |
| InChI | InChI=1S/C16H15N5O3/c1-20-7-6-13(19-20)15(22)17-8-11-9-21(10-18-11)14-5-3-2-4-12(14)16(23)24/h2-7,9-10H,8H2,1H3,(H,17,22)(H,23,24) |
| InChIKey | GPCAFHUQQUEUJR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |