C21H25N3O — CID 110098621
[(3aR,4R,6aS)-4-[(5-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-methyl-2-pyridinyl)methanone (PubChem CID 110098621) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[(5-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-methyl-2-pyridinyl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-[(5-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 110098621 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | [(3aR,4R,6aS)-4-[(5-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(3-methyl-2-pyridinyl)methanone |
| SMILES | Cc1ccc(C[C@H]2CC[C@@H]3CN(C(=O)c4ncccc4C)C[C@H]23)nc1 |
| InChI | InChI=1S/C21H25N3O/c1-14-5-8-18(23-11-14)10-16-6-7-17-12-24(13-19(16)17)21(25)20-15(2)4-3-9-22-20/h3-5,8-9,11,16-17,19H,6-7,10,12-13H2,1-2H3/t16-,17-,19-/m1/s1 |
| InChIKey | DPGGCUOMYGGGDF-ZHALLVOQSA-N |
| XLogP | 3.43 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |