C15H22O2 — CID 11009895
(5R,6S,11R)-6-hydroxy-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-one (PubChem CID 11009895) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (5R,6S,11R)-6-hydroxy-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-one.
| Compound Name | (5R,6S,11R)-6-hydroxy-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-one |
|---|---|
| PubChem CID | 11009895 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (5R,6S,11R)-6-hydroxy-5,7,7,11-tetramethyltricyclo[6.3.0.01,5]undec-2-en-4-one |
| SMILES | C[C@@H]1CCC2C(C)(C)[C@H](O)[C@]3(C)C(=O)C=CC213 |
| InChI | InChI=1S/C15H22O2/c1-9-5-6-10-13(2,3)12(17)14(4)11(16)7-8-15(9,10)14/h7-10,12,17H,5-6H2,1-4H3/t9-,10?,12+,14+,15?/m1/s1 |
| InChIKey | RPAMEABXKIBXSD-AVJLOEKESA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |