C18H26N4O4S — CID 110099053
3-[6-(1-methylsulfonylpiperidin-3-yl)pyrazin-2-yl]-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 110099053) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-[6-(1-methylsulfonylpiperidin-3-yl)pyrazin-2-yl]-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | 3-[6-(1-methylsulfonylpiperidin-3-yl)pyrazin-2-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 110099053 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[6-(1-methylsulfonylpiperidin-3-yl)pyrazin-2-yl]-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | CS(=O)(=O)N1CCCC(c2cncc(N3CC4(CCCCC4)OC3=O)n2)C1 |
| InChI | InChI=1S/C18H26N4O4S/c1-27(24,25)21-9-5-6-14(12-21)15-10-19-11-16(20-15)22-13-18(26-17(22)23)7-3-2-4-8-18/h10-11,14H,2-9,12-13H2,1H3 |
| InChIKey | OHALUYXLULFRNV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |