About (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone
(2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone (PubChem CID 110100149) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone.
Molecular Properties
| Compound Name | (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone |
| PubChem CID | 110100149 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone |
| SMILES | CC1(c2ccnc3ccnn23)CCCN1C(=O)C1CCOCC1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(14-3-8-18-15-4-9-19-21(14)15)7-2-10-20(17)16(22)13-5-11-23-12-6-13/h3-4,8-9,13H,2,5-7,10-12H2,1H3 |
| InChIKey | AKIPKMZOTHYPAZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone?
The IUPAC name of (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone (CID 110100149) is (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone.
What is the SMILES notation for (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone?
The canonical SMILES for (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone is CC1(c2ccnc3ccnn23)CCCN1C(=O)C1CCOCC1.
What is the InChIKey of (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone?
The InChIKey is AKIPKMZOTHYPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-17(14-3-8-18-15-4-9-19-21(14)15)7-2-10-20(17)16(22)13-5-11-23-12-6-13/h3-4,8-9,13H,2,5-7,10-12H2,1H3.
What are the key properties of (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone?
(2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone has a molecular weight of 314.39 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-pyrazolo[1,5-a]pyrimidin-7-ylpyrrolidin-1-yl)-(oxan-4-yl)methanone is sourced from PubChem (CID 110100149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).