C12H16O5 — CID 11010067
[(3aS,4R,7aR)-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 11010067) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(3aS,4R,7aR)-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,7aR)-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11010067 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(3aS,4R,7aR)-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C=O)=C[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C12H16O5/c1-7(14)15-9-4-8(6-13)5-10-11(9)17-12(2,3)16-10/h5-6,9-11H,4H2,1-3H3/t9-,10-,11+/m1/s1 |
| InChIKey | VLXTUIWREKFFDE-MXWKQRLJSA-N |
| XLogP | 0.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|