C12H20N2O3 — CID 11010076
(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-3-one (PubChem CID 11010076) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-3-one.
| Compound Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-3-one |
|---|---|
| PubChem CID | 11010076 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-3-one |
| SMILES | CC1(C)OC[C@H]([C@H]2CC(=O)N3CCCCN23)O1 |
| InChI | InChI=1S/C12H20N2O3/c1-12(2)16-8-10(17-12)9-7-11(15)14-6-4-3-5-13(9)14/h9-10H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | AGRIVVMIXPGVLE-NXEZZACHSA-N |
| XLogP | 0.75 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |