C12H18O5 — CID 11010120
ethyl (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopent-4-enoate (PubChem CID 11010120) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopent-4-enoate.
| Compound Name | ethyl (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 11010120 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopent-4-enoate |
| SMILES | CCOC(=O)CC(=O)/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H18O5/c1-4-15-11(14)7-9(13)5-6-10-8-16-12(2,3)17-10/h5-6,10H,4,7-8H2,1-3H3/b6-5+/t10-/m0/s1 |
| InChIKey | LGELHXADIOROFG-PORFMDCZSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|