About 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide
1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide (PubChem CID 11010276) has the molecular formula C11H9N3O2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide.
Molecular Properties
| Compound Name | 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide |
| PubChem CID | 11010276 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide |
| SMILES | COc1cc(C#N)c(NC(=S)C#N)cc1OC |
| InChI | InChI=1S/C11H9N3O2S/c1-15-9-3-7(5-12)8(4-10(9)16-2)14-11(17)6-13/h3-4H,1-2H3,(H,14,17) |
| InChIKey | DURCPCWOMROJJN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide?
The IUPAC name of 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide (CID 11010276) is 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide.
What is the SMILES notation for 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide?
The canonical SMILES for 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide is COc1cc(C#N)c(NC(=S)C#N)cc1OC.
What is the InChIKey of 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide?
The InChIKey is DURCPCWOMROJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2S/c1-15-9-3-7(5-12)8(4-10(9)16-2)14-11(17)6-13/h3-4H,1-2H3,(H,14,17).
What are the key properties of 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide?
1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide has a molecular weight of 247.28 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(2-cyano-4,5-dimethoxyphenyl)methanethioamide is sourced from PubChem (CID 11010276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).