C15H20O3 — CID 11010313
(6S,6aS)-6-propan-2-yl-1,5,6,6a,7,8-hexahydrobenzo[f][1,3]benzodioxin-9-one (PubChem CID 11010313) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (6S,6aS)-6-propan-2-yl-1,5,6,6a,7,8-hexahydrobenzo[f][1,3]benzodioxin-9-one.
| Compound Name | (6S,6aS)-6-propan-2-yl-1,5,6,6a,7,8-hexahydrobenzo[f][1,3]benzodioxin-9-one |
|---|---|
| PubChem CID | 11010313 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (6S,6aS)-6-propan-2-yl-1,5,6,6a,7,8-hexahydrobenzo[f][1,3]benzodioxin-9-one |
| SMILES | CC(C)[C@@H]1CC2=C(COCO2)C2=CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C15H20O3/c1-9(2)12-6-15-14(7-17-8-18-15)13-5-10(16)3-4-11(12)13/h5,9,11-12H,3-4,6-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | KWALOYCYJCRTCT-RYUDHWBXSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |