C13H15NO4 — CID 11010346
(2S,3aS,7S)-2-(hydroxymethyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one (PubChem CID 11010346) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S,3aS,7S)-2-(hydroxymethyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one.
| Compound Name | (2S,3aS,7S)-2-(hydroxymethyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 11010346 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S,3aS,7S)-2-(hydroxymethyl)-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N2O[C@H](CO)C[C@@H]12 |
| InChI | InChI=1S/C13H15NO4/c15-7-10-6-11-13(16)17-8-12(14(11)18-10)9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2/t10-,11-,12+/m0/s1 |
| InChIKey | QCGPKVPGBDFSFU-SDDRHHMPSA-N |
| XLogP | 0.65 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |