C12H22N4O3S — CID 110105054
N,N-diethyl-2-(5-methyl-1H-imidazol-2-yl)morpholine-4-sulfonamide (PubChem CID 110105054) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is N,N-diethyl-2-(5-methyl-1H-imidazol-2-yl)morpholine-4-sulfonamide.
| Compound Name | N,N-diethyl-2-(5-methyl-1H-imidazol-2-yl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 110105054 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N,N-diethyl-2-(5-methyl-1H-imidazol-2-yl)morpholine-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCOC(c2ncc(C)[nH]2)C1 |
| InChI | InChI=1S/C12H22N4O3S/c1-4-15(5-2)20(17,18)16-6-7-19-11(9-16)12-13-8-10(3)14-12/h8,11H,4-7,9H2,1-3H3,(H,13,14) |
| InChIKey | JCOGZLABYJGEMO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |