C7H5F8N — CID 11010541
4,4,5,5,6,6,7,7-octafluoroheptanenitrile (PubChem CID 11010541) has the molecular formula C7H5F8N and a molecular weight of 255.11 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoroheptanenitrile.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoroheptanenitrile |
|---|---|
| PubChem CID | 11010541 |
| Molecular Formula | C7H5F8N |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoroheptanenitrile |
| SMILES | N#CCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F8N/c8-4(9)6(12,13)7(14,15)5(10,11)2-1-3-16/h4H,1-2H2 |
| InChIKey | VQHBCVICAFEMBZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|