C15H17N5O2 — CID 110105582
3-[2-[2-(methylamino)-4-pyridinyl]pyrrolidine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 110105582) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-[2-[2-(methylamino)-4-pyridinyl]pyrrolidine-1-carbonyl]-1H-pyridazin-6-one.
| Compound Name | 3-[2-[2-(methylamino)-4-pyridinyl]pyrrolidine-1-carbonyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 110105582 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[2-[2-(methylamino)-4-pyridinyl]pyrrolidine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | CNc1cc(C2CCCN2C(=O)c2ccc(=O)[nH]n2)ccn1 |
| InChI | InChI=1S/C15H17N5O2/c1-16-13-9-10(6-7-17-13)12-3-2-8-20(12)15(22)11-4-5-14(21)19-18-11/h4-7,9,12H,2-3,8H2,1H3,(H,16,17)(H,19,21) |
| InChIKey | ZJPAGWORDIFEBB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |