About 3,5-dibromo-2,3-dihydropyran-6-one
3,5-dibromo-2,3-dihydropyran-6-one (PubChem CID 11010568) has the molecular formula C5H4Br2O2
and a molecular weight of 255.89 g/mol. Its IUPAC name is 3,5-dibromo-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 3,5-dibromo-2,3-dihydropyran-6-one |
| PubChem CID | 11010568 |
| Molecular Formula | C5H4Br2O2 |
| Molecular Weight | 255.89 g/mol |
| Exact Mass | 253.86 |
| IUPAC Name | 3,5-dibromo-2,3-dihydropyran-6-one |
| SMILES | O=C1OCC(Br)C=C1Br |
| InChI | InChI=1S/C5H4Br2O2/c6-3-1-4(7)5(8)9-2-3/h1,3H,2H2 |
| InChIKey | JDISJGGRGCJYPN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.89 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2,3-dihydropyran-6-one?
The IUPAC name of 3,5-dibromo-2,3-dihydropyran-6-one (CID 11010568) is 3,5-dibromo-2,3-dihydropyran-6-one.
What is the SMILES notation for 3,5-dibromo-2,3-dihydropyran-6-one?
The canonical SMILES for 3,5-dibromo-2,3-dihydropyran-6-one is O=C1OCC(Br)C=C1Br.
What is the InChIKey of 3,5-dibromo-2,3-dihydropyran-6-one?
The InChIKey is JDISJGGRGCJYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Br2O2/c6-3-1-4(7)5(8)9-2-3/h1,3H,2H2.
What are the key properties of 3,5-dibromo-2,3-dihydropyran-6-one?
3,5-dibromo-2,3-dihydropyran-6-one has a molecular weight of 255.89 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2,3-dihydropyran-6-one is sourced from PubChem (CID 11010568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).