C18H27N5 — CID 110105848
4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-3-yl]-N-methylpyridin-2-amine (PubChem CID 110105848) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-3-yl]-N-methylpyridin-2-amine.
| Compound Name | 4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-3-yl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 110105848 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-3-yl]-N-methylpyridin-2-amine |
| SMILES | CCc1nc(CN2CCCC(c3ccnc(NC)c3)C2)c(C)[nH]1 |
| InChI | InChI=1S/C18H27N5/c1-4-17-21-13(2)16(22-17)12-23-9-5-6-15(11-23)14-7-8-20-18(10-14)19-3/h7-8,10,15H,4-6,9,11-12H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | XJVHALPHGWBKLC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |