C16H19NO2 — CID 11010637
(1R,2R,8S)-1-ethenyl-2-phenylmethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11010637) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1R,2R,8S)-1-ethenyl-2-phenylmethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,2R,8S)-1-ethenyl-2-phenylmethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11010637 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1R,2R,8S)-1-ethenyl-2-phenylmethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C=C[C@H]1[C@@H](OCc2ccccc2)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C16H19NO2/c1-2-13-14-9-6-10-17(14)16(18)15(13)19-11-12-7-4-3-5-8-12/h2-5,7-8,13-15H,1,6,9-11H2/t13-,14+,15-/m1/s1 |
| InChIKey | OGLORFCUSGNYNJ-QLFBSQMISA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|