C18H23N3O3 — CID 110106487
2-(4-methoxyphenoxy)-1-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 110106487) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-1-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-methoxyphenoxy)-1-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110106487 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(4-methoxyphenoxy)-1-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | COc1ccc(OCC(=O)N2CCCC(Cc3ccn[nH]3)C2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-23-16-4-6-17(7-5-16)24-13-18(22)21-10-2-3-14(12-21)11-15-8-9-19-20-15/h4-9,14H,2-3,10-13H2,1H3,(H,19,20) |
| InChIKey | QNGQCXCTHCEJKU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |