C20H22N4O — CID 110106635
isoquinolin-1-yl-[3-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methanone (PubChem CID 110106635) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is isoquinolin-1-yl-[3-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methanone.
| Compound Name | isoquinolin-1-yl-[3-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110106635 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | isoquinolin-1-yl-[3-[(4-methyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methanone |
| SMILES | Cc1cn[nH]c1CC1CCCN(C(=O)c2nccc3ccccc23)C1 |
| InChI | InChI=1S/C20H22N4O/c1-14-12-22-23-18(14)11-15-5-4-10-24(13-15)20(25)19-17-7-3-2-6-16(17)8-9-21-19/h2-3,6-9,12,15H,4-5,10-11,13H2,1H3,(H,22,23) |
| InChIKey | RTBHNJFZEDUJRA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |