About 11-methylpyrido[3,2-a]phenoxazin-5-one
11-methylpyrido[3,2-a]phenoxazin-5-one (PubChem CID 11010774) has the molecular formula C16H10N2O2
and a molecular weight of 262.27 g/mol. Its IUPAC name is 11-methylpyrido[3,2-a]phenoxazin-5-one.
Molecular Properties
| Compound Name | 11-methylpyrido[3,2-a]phenoxazin-5-one |
| PubChem CID | 11010774 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 11-methylpyrido[3,2-a]phenoxazin-5-one |
| SMILES | Cc1cccc2oc3cc(=O)c4ncccc4c-3nc12 |
| InChI | InChI=1S/C16H10N2O2/c1-9-4-2-6-12-14(9)18-16-10-5-3-7-17-15(10)11(19)8-13(16)20-12/h2-8H,1H3 |
| InChIKey | MSMRCJQNVPASJT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-methylpyrido[3,2-a]phenoxazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methylpyrido[3,2-a]phenoxazin-5-one?
The IUPAC name of 11-methylpyrido[3,2-a]phenoxazin-5-one (CID 11010774) is 11-methylpyrido[3,2-a]phenoxazin-5-one.
What is the SMILES notation for 11-methylpyrido[3,2-a]phenoxazin-5-one?
The canonical SMILES for 11-methylpyrido[3,2-a]phenoxazin-5-one is Cc1cccc2oc3cc(=O)c4ncccc4c-3nc12.
What is the InChIKey of 11-methylpyrido[3,2-a]phenoxazin-5-one?
The InChIKey is MSMRCJQNVPASJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O2/c1-9-4-2-6-12-14(9)18-16-10-5-3-7-17-15(10)11(19)8-13(16)20-12/h2-8H,1H3.
What are the key properties of 11-methylpyrido[3,2-a]phenoxazin-5-one?
11-methylpyrido[3,2-a]phenoxazin-5-one has a molecular weight of 262.27 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methylpyrido[3,2-a]phenoxazin-5-one is sourced from PubChem (CID 11010774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).