About 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one
4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one (PubChem CID 110108048) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one |
| PubChem CID | 110108048 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C(=O)N2C[C@@H](O)[C@H](N(C)C)C2)nc(=O)[nH]1 |
| InChI | InChI=1S/C12H18N4O3/c1-7-4-8(14-12(19)13-7)11(18)16-5-9(15(2)3)10(17)6-16/h4,9-10,17H,5-6H2,1-3H3,(H,13,14,19)/t9-,10-/m1/s1 |
| InChIKey | VUMGAFJKKKVNME-NXEZZACHSA-N |
| XLogP | -1.17 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one?
The IUPAC name of 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one (CID 110108048) is 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one.
What is the SMILES notation for 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one?
The canonical SMILES for 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one is Cc1cc(C(=O)N2C[C@@H](O)[C@H](N(C)C)C2)nc(=O)[nH]1.
What is the InChIKey of 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one?
The InChIKey is VUMGAFJKKKVNME-NXEZZACHSA-N. The full InChI is InChI=1S/C12H18N4O3/c1-7-4-8(14-12(19)13-7)11(18)16-5-9(15(2)3)10(17)6-16/h4,9-10,17H,5-6H2,1-3H3,(H,13,14,19)/t9-,10-/m1/s1.
What are the key properties of 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one?
4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one has a molecular weight of 266.30 g/mol, XLogP of -1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidine-1-carbonyl]-6-methyl-1H-pyrimidin-2-one is sourced from PubChem (CID 110108048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).