About 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone
2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone (PubChem CID 110108722) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 110108722 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CCOCC(=O)N1C[C@@H](O)[C@H](N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-2-24-14-18(23)21-12-16(17(22)13-21)20-10-8-19(9-11-20)15-6-4-3-5-7-15/h3-7,16-17,22H,2,8-14H2,1H3/t16-,17-/m1/s1 |
| InChIKey | UPOZGUSNRKRTJZ-IAGOWNOFSA-N |
| XLogP | 0.42 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone (CID 110108722) is 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone is CCOCC(=O)N1C[C@@H](O)[C@H](N2CCN(c3ccccc3)CC2)C1.
What is the InChIKey of 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone?
The InChIKey is UPOZGUSNRKRTJZ-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-2-24-14-18(23)21-12-16(17(22)13-21)20-10-8-19(9-11-20)15-6-4-3-5-7-15/h3-7,16-17,22H,2,8-14H2,1H3/t16-,17-/m1/s1.
What are the key properties of 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone?
2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone has a molecular weight of 333.43 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1-[(3R,4R)-3-hydroxy-4-(4-phenylpiperazin-1-yl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 110108722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).