C12H23N3O4S — CID 110108846
N-[2-[3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 110108846) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[2-[3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-[3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110108846 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[2-[3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(=O)N1CCC(O)(CN2CCCC2)C1 |
| InChI | InChI=1S/C12H23N3O4S/c1-20(18,19)13-8-11(16)15-7-4-12(17,10-15)9-14-5-2-3-6-14/h13,17H,2-10H2,1H3 |
| InChIKey | DWVXVYVHAAEAOP-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |