About 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol
3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol (PubChem CID 110108990) has the molecular formula C12H22F2N2O3S
and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol |
| PubChem CID | 110108990 |
| Molecular Formula | C12H22F2N2O3S |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol |
| SMILES | CCS(=O)(=O)N1CCC(O)(CN2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C12H22F2N2O3S/c1-2-20(18,19)16-8-3-11(17,10-16)9-15-6-4-12(13,14)5-7-15/h17H,2-10H2,1H3 |
| InChIKey | XGDOTELOHGXQNF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol?
The IUPAC name of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol (CID 110108990) is 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol.
What is the SMILES notation for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol?
The canonical SMILES for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol is CCS(=O)(=O)N1CCC(O)(CN2CCC(F)(F)CC2)C1.
What is the InChIKey of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol?
The InChIKey is XGDOTELOHGXQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O3S/c1-2-20(18,19)16-8-3-11(17,10-16)9-15-6-4-12(13,14)5-7-15/h17H,2-10H2,1H3.
What are the key properties of 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol?
3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol has a molecular weight of 312.38 g/mol, XLogP of 0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-difluoropiperidin-1-yl)methyl]-1-ethylsulfonylpyrrolidin-3-ol is sourced from PubChem (CID 110108990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).