C10H21NO7 — CID 11010961
(2S,3S,4S)-6,6-dimethoxy-2-(methoxymethoxy)-4-nitrohexan-3-ol (PubChem CID 11010961) has the molecular formula C10H21NO7 and a molecular weight of 267.28 g/mol. Its IUPAC name is (2S,3S,4S)-6,6-dimethoxy-2-(methoxymethoxy)-4-nitrohexan-3-ol.
| Compound Name | (2S,3S,4S)-6,6-dimethoxy-2-(methoxymethoxy)-4-nitrohexan-3-ol |
|---|---|
| PubChem CID | 11010961 |
| Molecular Formula | C10H21NO7 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2S,3S,4S)-6,6-dimethoxy-2-(methoxymethoxy)-4-nitrohexan-3-ol |
| SMILES | COCO[C@@H](C)[C@@H](O)[C@H](CC(OC)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C10H21NO7/c1-7(18-6-15-2)10(12)8(11(13)14)5-9(16-3)17-4/h7-10,12H,5-6H2,1-4H3/t7-,8-,10+/m0/s1 |
| InChIKey | GIHDGLMKAKNWNB-OYNCUSHFSA-N |
| XLogP | 0.01 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|