C20H22N6O — CID 110110205
[4-[[6-(1-methylimidazol-2-yl)pyrazin-2-yl]methyl]piperidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 110110205) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [4-[[6-(1-methylimidazol-2-yl)pyrazin-2-yl]methyl]piperidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[[6-(1-methylimidazol-2-yl)pyrazin-2-yl]methyl]piperidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110110205 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [4-[[6-(1-methylimidazol-2-yl)pyrazin-2-yl]methyl]piperidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | Cn1ccnc1-c1cncc(CC2CCN(C(=O)c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C20H22N6O/c1-25-11-8-23-19(25)18-14-21-13-16(24-18)12-15-5-9-26(10-6-15)20(27)17-4-2-3-7-22-17/h2-4,7-8,11,13-15H,5-6,9-10,12H2,1H3 |
| InChIKey | WEOKOLSFYNMJDM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |